17β-HSD10-IN-1 (compound 9) is an orally active, blood-brain permeable inhibitor of 17β-hydroxysteroid dehydrogenase type 10 (17β-HSD10). It exhibits no mitochondrial off-target, cytotoxic, or neurotoxic effects.
| Purity | 97.16% |
|---|---|
| Formula | C16H13ClN4O3S |
| Molecular Weight | 376.82 |
| SMILES | O=C(NC1=CC=C(C(Cl)=C1)O)NC(SC2=C3)=NC2=CC=C3NC(C)=O |
| Appearance | Solid |
| Color | Pale purple to purple |
| Biological Target | Endogenous Metabolite |
| Target | 17β-HSD10 |
| Initial Source | Endogenous metabolite |
| Solubility | DMSO: 25 mg/mL (66.34 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet