Afzelin (Kaempferol-3-O-rhamnoside) is a flavonol glycoside with anti-inflammatory, anti-oxidative stress, anti-apoptotic, and anti-cardiac cytotoxic effects. It reduces mitochondrial damage, enhances mitochondrial biosynthesis, and lowers levels of mitochondria-related proteins like Parkin and PTEN-induced putative kinase 1.
| Synonyms | Kaempferol-3-O-rhamnoside |
|---|---|
| Purity | 99.62% |
| Formula | C21H20O10 |
| Molecular Weight | 432.38 |
| SMILES | O=C1C(O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)=C(C3=CC=C(O)C=C3)OC4=CC(O)=CC(O)=C14 |
| Appearance | Solid |
| Color | Light yellow to yellow |
| Biological Target | Mitochondrial Metabolism; PTEN; Autophagy; Bacterial |
| Initial Source | Plants; Saururaceae; Houttuynia cordata Thunb. |
| Solubility | DMSO: 116.67 mg/mL (269.83 mM, need ultrasonic); Ethanol: 12.5 mg/mL (28.91 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet