alpha-Hederin (α-Hederin), a monodesmosidic triterpenoid saponin, shows promising antitumor potential against various human cancer cell lines. It inhibits proliferation and induces apoptosis in gastric cancer, accompanied by glutathione decrement and ROS generation via a mitochondrial-dependent pathway.
| Synonyms | α-Hederin |
|---|---|
| Purity | 99.11% |
| Formula | C41H66O12 |
| Molecular Weight | 750.96 |
| SMILES | OC[C@@]1(C)[C@]2([H])CC[C@@]3(C)[C@]4(C)CC[C@@]5(C(O)=O)CCC(C)(C)C[C@@]5([H])C4=CC[C@]3([H])[C@@]2(C)CC[C@@H]1O[C@]6([H])OC[C@H](O)[C@H](O)[C@H]6O[C@@]7([H])[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O7 |
| Appearance | Solid |
| Color | White to off-white |
| Biological Target | Apoptosis |
| Initial Source | Plants; Araliaceae; Hedera nepalensis K. Koch var. sinensis (Tobl.) Rehd. |
| Solubility | DMSO: 100 mg/mL (133.16 mM); H2O: < 0.1 mg/mL (insoluble) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet