Apoptolidin, a polyketide from Nocardiopsis bacteria, is a selective mitochondrial F1FO ATPase inhibitor. It induces apoptosis, causing cell death in adenovirus type 12 oncogene-transformed cells (e.g., E1A) with an IC50 of 10-17 ng/mL, but not in normal cells.
| Purity | 95.60% |
|---|---|
| Formula | C58H96O21 |
| Molecular Weight | 1129.37 |
| SMILES | O[C@H]([C@](OC(/C(C)=C/C(C)=C/C(C)=C/[C@H]1C)=O)([H])C[C@@H]([C@H](CC/C=C(/C=C/[C@H]1O[C@H](O[C@H]2C)[C@H]([C@@H]([C@H]2OC)O)O)C)O)OC)[C@](O[C@@H]([C@@H]3C)C[C@H](COC)O[C@H](O[C@H]4C)C[C@](O)([C@H]4O[C@H](O[C@@H]5C)C[C@H]([C@@H]5O)OC)C)([C@@H]([C@H]3O)C)O |
| Appearance | Solid |
| Color | White to off-white |
| Biological Target | ATP Synthase; Apoptosis |
| Initial Source | Microorganisms; Nocardiopsis |
| Solubility | DMSO: 1 mg/mL (0.89 mM, need ultrasonic and warming) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet