Products
Online Inquiry
Ardisiacrispin B exhibits cytotoxic effects in multi-drug resistant cancer cells through ferroptotic and apoptotic cell death.
| Purity | 99.49% |
|---|---|
| Formula | C53H86O22 |
| Molecular Weight | 1075.24 |
| SMILES | C[C@]12[C@]3(CC[C@@]4([H])[C@]2(CC[C@]5([H])[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O[C@@H]9O[C@@H]([C@H]([C@@H]([C@H]9O)O)O)CO)C)C)[C@@]%10([H])[C@@]([C@@H](C1)O)(CC[C@@](C)(C%10)C=O)CO3 |
| Appearance | Solid |
| Color | White to off-white |
| Biological Target | Apoptosis; Ferroptosis |
| Initial Source | Plants; Myrsinaceae; Ardisia crenata Sims |
| Solubility | DMSO: 100 mg/mL (93.00 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |