Atractyloside potassium salt is a powerful and specific inhibitor of mitochondrial ADP/ATP transport. It inhibits chloride channels in rat heart mitochondrial membranes, activates autophagy, inhibits ANT2 and mTOR, and promotes p-AMPK activation. It exhibits anticancer effects on non-small cell lung cancer and can inhibit liver steatosis, but also has nephrotoxicity.
| Purity | 99.24% |
|---|---|
| Formula | C30H44K2O16S2 |
| Molecular Weight | 802.99 |
| SMILES | [H][C@@]12C(C(O)=O)C[C@@H](O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)OS(=O)(O[K])=O)OS(=O)(O[K])=O)OC(CC(C)C)=O)C[C@@]1(C)[C@@]4([H])[C@@]5([C@@H](O)C([C@H](CC4)C5)=C)CC2 |
| Appearance | Solid |
| Color | White to light yellow |
| Biological Target | Chloride Channel; Autophagy; mTOR; AMPK |
| Initial Source | Plants; Leguminosae; Pterocarpus soyauxii Taub.; Plants; Compositae |
| Solubility | DMSO: 250 mg/mL (311.34 mM, need ultrasonic); H2O: 66.67 mg/mL (83.03 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | 4°C, sealed storage, away from moisture and light |
Datasheet