Avenanthramide A, a phytoalexin from oats (Avena sativa L.), targets RNA helicase DDX3. It causes mitochondrial swelling, increased ROS production, and induces apoptosis in CRC cells. Orally active, it exhibits antitumor efficacy in mouse models.
| Purity | 99.20% |
|---|---|
| Formula | C16H13NO5 |
| Molecular Weight | 299.28 |
| SMILES | O=C(C1=CC(O)=CC=C1NC(/C=C/C2=CC=C(C=C2)O)=O)O |
| Appearance | Solid |
| Color | White to light brown |
| Biological Target | Reactive Oxygen Species; Apoptosis |
| Initial Source | Plants; Gramineae; Avena sativa Linn. |
| Solubility | DMSO: 100 mg/mL (334.14 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet