Carboxyatractyloside (Gummiferin) tripotassium is a toxic natural product that inhibits mitochondrial ADP/ATP transport. It is used to study cellular energy metabolism and mitochondrial biology.
| Synonyms | Gummiferin tripotassium |
|---|---|
| Purity | 99.74% |
| Formula | C31H43K3O18S2 |
| Molecular Weight | 885.09 |
| SMILES | C=C([C@H](CC1)C2)[C@H](O)[C@@]32CC[C@]4([H])[C@@](C(O)=O)(C(O[K])=O)C[C@@H](O[C@@H]5[C@H]([C@@H]([C@H]([C@H](CO)O5)OS(=O)(O[K])=O)OS(=O)(O[K])=O)OC(CC(C)C)=O)C[C@@]4(C)[C@@]31[H] |
| Appearance | Solid |
| Color | White to off-white |
| Biological Target | Others |
| Initial Source | Plants; other families |
| Shipping Conditions | Room Temperature |
| Storage Information | -20°C, sealed storage, away from moisture and light |
Datasheet