Products
Online Inquiry
Chaetoglobosin E is a ferroptosis inducer with significant cytotoxicity against human tumor cell lines MDA-MB231 (IC50=9.14 μM) and A549 (IC50=7.47 μM). It downregulates GPX4 in A549 cells, increasing intracellular Fe2+ and MDA, leading to mitochondrial shrinkage, cristae reduction, and ferroptosis induction. It's used in cancer research.
| Formula | C32H38N2O5 |
|---|---|
| Molecular Weight | 530.65 |
| SMILES | CC1=C(C)[C@]([C@@H](N2)CC3=CNC4=C3C=CC=C4)([H])[C@@]([C@](/C=C/C[C@H](C)/C=C5\C)([H])[C@@H]1O)(C(CC[C@H](O)C5=O)=O)C2=O |
| Biological Target | Ferroptosis |
| Initial Source | Microorganisms; endophytic Chaetomium sp |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |