Dioscin (CCRIS 4123; Collettiside III) is a natural plant-derived steroidal saponin with good anticancer activity against various cell lines. It causes DNA damage and induces apoptosis in HeLa and SiHa cells, and regulates ROS-mediated DNA damage and mitochondrial signaling pathways, exerting anticancer activity.
| Synonyms | Collettiside III; CCRIS 4123 |
|---|---|
| Purity | 99.95% |
| Formula | C45H72O16 |
| Molecular Weight | 869.04 |
| SMILES | O[C@@H]1[C@@H](O)[C@H](C)O[C@@]([H])(O[C@H]2[C@H](O)[C@@H](O[C@]3([H])O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@](O[C@@H]4CC5=CC[C@]([C@]([H])(C[C@@]6([H])[C@]7([H])[C@H](C)[C@]8(OC[C@H](C)CC8)O6)[C@]7(C)CC9)([H])[C@@]9([H])[C@@]5(C)CC4)([H])O[C@@H]2CO)[C@@H]1O |
| Appearance | Solid |
| Color | White to off-white |
| Biological Target | Autophagy; Apoptosis |
| Initial Source | Plants; other families |
| Solubility | DMSO: 100 mg/mL (115.07 mM) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet