Eupatorin, a natural flavone, arrests cells at the G2-M phase and induces apoptotic cell death. This involves activating multiple caspases, mitochondrial release of cytochrome c, and poly(ADP-ribose) polymerase cleavage.
| Purity | 99.97% |
|---|---|
| Formula | C18H16O7 |
| Molecular Weight | 344.32 |
| SMILES | O=C1C=C(C2=CC=C(OC)C(O)=C2)OC3=CC(OC)=C(OC)C(O)=C13 |
| Appearance | Solid |
| Color | Light yellow to yellow |
| Biological Target | Apoptosis |
| Initial Source | Plants; Cruciferae; Isatis tinctoria L. |
| Solubility | DMSO: 250 mg/mL (726.07 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet