Malonyl CoA is a fatty acid biosynthesis substrate and an inhibitor of fatty acid oxidation. It also reversibly inhibits mitochondrial carnitine palmitoyltransferase (CPT) 1.
| Synonyms | Malonyl coenzyme A |
|---|---|
| Formula | C24H38N7O19P3S |
| Molecular Weight | 853.58 |
| SMILES | O[C@H]1[C@](O[C@@H]([C@H]1OP(O)(O)=O)COP(OP(OCC(C)(C)[C@@H](O)C(NCCC(NCCSC(CC(O)=O)=O)=O)=O)(O)=O)(O)=O)([H])N2C3=NC=NC(N)=C3N=C2 |
| Biological Target | Endogenous Metabolite; Mitochondrial Metabolism |
| Target | Human Endogenous Metabolite |
| Initial Source | Endogenous metabolite; Human Gut Microbiota Metabolites |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet