Products
Online Inquiry
3, 3'-Dihexyloxacarbocyanine iodide is a carbocyanine dye utilized for monitoring changes in mitochondrial membrane potential.
| Detection Method | Fluorescent |
|---|---|
| Assay Platform | Fluorescence microscopy |
| Purity | 99.17% |
| CAS Number | 53213-82-4 |
| Formula | C29H37IN2O2 |
| Molecular Weight | 572.52 |
| SMILES | CCCCCCN1/C(OC2=CC=CC=C12)=C/C=C/C3=[N+](CCCCCC)C4=CC=CC=C4O3.[I-] |
| Appearance | Solid |
| Color | Orange to red |
| Emission (Em) | 515 |
| Excitation (Ex) | 486 |
| Solubility | DMSO: 33.33 mg/mL (58.22 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | 4°C, sealed storage, away from moisture and light |