4-Di-2-ASP, a styryl pyridinium fluorescent dye, serves as a vital mitochondrial marker, providing reliable and specific labeling of pulmonary neuroepithelial bodies (NEBs).
| Detection Method | Fluorescent |
|---|---|
| Purity | 99.05% |
| CAS Number | 105802-46-8 |
| Formula | C18H23IN2 |
| Molecular Weight | 394.29 |
| SMILES | C[N+]1=CC=C(/C=C/C2=CC=C(N(CC)CC)C=C2)C=C1.[I-] |
| Appearance | Solid |
| Color | Brown to red |
| Emission (Em) | 603 |
| Excitation (Ex) | 485 |
| Solubility | DMSO: 100 mg/mL (253.62 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | 4°C, sealed storage, away from moisture and light |
Datasheet