Products
Online Inquiry
Cyanine5 alkyne (Alkyne-Cy5) is a fluorescent dye utilized for labeling azide proteins and analyzing post-translational modifications such as glycosylation. It also functions as a mitochondrial OXPHOS inhibitor, hindering the growth of cancer stem cells (CSCs).
| Detection Method | Fluorescent |
|---|---|
| Purity | 98.15% |
| CAS Number | 1223357-57-0 |
| Formula | C35H42ClN3O |
| Molecular Weight | 556.18 |
| SMILES | C#CCNC(CCCCC[N+]1=C(/C=C/C=C/C=C2N(C)C3=C(C=CC=C3)C\2(C)C)C(C)(C)C4=C1C=CC=C4)=O.[Cl-] |
| Appearance | Solid |
| Color | Brown to black |
| Emission (Em) | 670 |
| Excitation (Ex) | 645 |
| Solubility | DMSO: 125 mg/mL (224.75 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | -20°C, sealed storage, away from moisture and light |