DASPEI is a cationic styrenyl mitochondrial dye, with excitation and emission wavelengths at 550/573 nm. It effectively stains mitochondria in living cells and can also label presynaptic nerve endings independently of neuronal activity.
| Sample Types | Suspension cells, Adherent cells |
|---|---|
| Detection Method | Fluorescent |
| Assay Type | Cell-based |
| Assay Platform | Fluorescence microscopy, Flow cytometry |
| Purity | 99.86% |
| CAS Number | 3785-01-1 |
| Formula | C17H21IN2 |
| Molecular Weight | 380.27 |
| SMILES | CN(C)C(C=C1)=CC=C1/C=C/C2=[N+](CC)C=CC=C2.[I-] |
| Appearance | Solid |
| Color | Purple to purplish red |
| Emission (Em) | 573 |
| Excitation (Ex) | 550 |
| Solubility | DMSO: 33.33 mg/mL (87.65 mM, ultrasonic and warming and heat to 60°C) |
| Shipping Conditions | Room Temperature |
| Storage Information | -20°C, sealed storage, away from moisture and light |
Datasheet