Products
Online Inquiry
HKOCl-4m is a selective, mitochondria-targeting rhodol-based fluorescent probe used to monitor mitochondrial hypochlorous acid (HOCl) levels.
| Sample Types | Adherent cells |
|---|---|
| Detection Method | Fluorescent |
| Assay Type | Cell-based |
| Assay Platform | Fluorescence microscope |
| Purity | 98.27% |
| CAS Number | 2031170-88-2 |
| Formula | C63H61BrCl2N3O7P |
| Molecular Weight | 1153.96 |
| SMILES | O=C1OC2(C3=CC=CC=C31)C4=CC(C(CC(C)5C)C)=C(N5CCCC(N(CC6)CCN6C(CCCC[P+](C7=CC=CC=C7)(C8=CC=CC=C8)C9=CC=CC=C9)=O)=O)C=C4OC%10=CC(OC(C=C%11Cl)=CC(Cl)=C%11O)=CC=C2%10.[Br-] |
| Appearance | Solid |
| Color | Pink to red |
| Emission (Em) | 527 |
| Excitation (Ex) | 490 |
| Solubility | DMSO: 52.5 mg/mL (45.50 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | -20°C, sealed storage, away from moisture and light |