Products
Online Inquiry
Mito Red is a vital dye and mitochondrial stain used to detect and evaluate mitochondrial function and status. It accumulates in mitochondria, and its fluorescence intensity directly correlates with mitochondrial membrane potential; as the potential increases, so does the Mito Red fluorescence signal.
| Detection Method | Fluorescent |
|---|---|
| CAS Number | 1021902-10-2 |
| Formula | C38H37ClN2O5 |
| Molecular Weight | 637.16 |
| SMILES | O=C1OC2=C(C(C)=C1)C=CC(OC(C3=C(C4=C5C=CC(N(CC)CC)=CC5=[O+]C6=C4C=CC(N(CC)CC)=C6)C=CC=C3)=O)=C2.[Cl-] |
| Shipping Conditions | Room Temperature |
| Storage Information | 4°C, 2 years; -20°C, 3 years |