MitoPerOx is a mitochondrial-targeted fluorescent probe, designed to indicate lipid peroxidation. Its triphenylphosphine cation (TPP+) component allows for selective mitochondrial enrichment (dependent on membrane potential), enabling the detection of lipid peroxidation in the inner mitochondrial membrane.
| Detection Method | Fluorescent |
|---|---|
| Assay Platform | Confocal microscopy |
| Purity | 98.14% |
| CAS Number | 1392820-50-6 |
| Formula | C42H38BBrF2N3OP |
| Molecular Weight | 760.46 |
| SMILES | O=C(CCC1=CC=C2[N-]1[B+3]([F-])([N]3=C(C=CC3=C2)/C=C/C=C/C4=CC=CC=C4)[F-])NCC[P+](C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7.[Br-] |
| Appearance | Solid |
| Color | Dark purple to black |
| Emission (Em) | 520/590 |
| Excitation (Ex) | 490 |
| Solubility | DMSO: 125 mg/mL (164.37 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | -20°C, sealed storage, away from moisture and light |
Datasheet