MitoSOX Red is a cell-permeable live cell fluorescent probe that specifically targets mitochondria. Upon entering mitochondria, it is oxidized by superoxide, but not by other ROS or RNS generating systems. The oxidized MitoSOX Red then binds to nucleic acids within mitochondria/nucleus, yielding strong red fluorescence.
| Sample Types | Suspension cells, Adherent cells |
|---|---|
| Detection Method | Fluorescent |
| Assay Type | Cell-based |
| Assay Platform | Fluorescence microscopy, Flow cytometry |
| Purity | 95.58% |
| CAS Number | 1003197-00-9 |
| Formula | C43H43IN3P |
| Molecular Weight | 759.70 |
| SMILES | NC1=CC(C(C2=CC=CC=C2)N(CCCCCC[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)C6=CC(N)=CC=C76)=C7C=C1.[I-] |
| Appearance | Solid |
| Color | Yellow to brown |
| Emission (Em) | 580 |
| Excitation (Ex) | 510 |
| Solubility | DMSO: 100 mg/mL (131.63 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | 4°C, 2 years; -20°C, 3 years |
Datasheet