MitoTracker Green is a green fluorescent dye that selectively accumulates in the mitochondrial matrix. It covalently binds to mitochondrial proteins by reacting with free mercaptan groups of cysteine residues, enabling mitochondrial staining independent of membrane potential.
| Detection Method | Fluorescent |
|---|---|
| Assay Platform | Fluorescence microscopy, Flow cytometry |
| Purity | 95.36% |
| CAS Number | 201860-17-5 |
| Formula | C34H28Cl5N3O |
| Molecular Weight | 671.87 |
| SMILES | C[N+]1=C(/C=C/C=C2N(CC3=CC=C(CCl)C=C3)C4=CC(Cl)=C(Cl)C=C4N\2CC5=CC=C(CCl)C=C5)OC6=CC=CC=C16.[Cl-] |
| Appearance | Solid |
| Color | Yellow to orange |
| Emission (Em) | 523 |
| Excitation (Ex) | 490 |
| Solubility | DMSO: 5 mg/mL (7.44 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | -20°C, sealed storage, away from moisture and light |
Datasheet