MitoTracker Orange CMTMRos is a fluorescent dye that labels mitochondria in live cells by leveraging the mitochondrial membrane potential (Ex/Em: 551/576 nm).
| Sample Types | Adherent cells |
|---|---|
| Detection Method | Fluorescent |
| Assay Type | Cell-based |
| Assay Platform | Fluorescence microscope |
| Purity | 92.08% |
| CAS Number | 199116-50-2 |
| Formula | C24H24Cl2N2O |
| Molecular Weight | 427.37 |
| SMILES | CN(C)C(C=C1)=CC2=C1C(C3=CC=C(CCl)C=C3)=C(C=C/4)C(O2)=CC4=[N+](C)/C.[Cl-] |
| Appearance | Solid |
| Color | Brown to black |
| Emission (Em) | 576 |
| Excitation (Ex) | 554 |
| Solubility | DMSO: 31.25 mg/mL (73.12 mM, ultrasonic and warming and heat to 60°C) |
| Shipping Conditions | Room Temperature |
| Storage Information | 4°C, sealed storage, away from moisture and light |
Datasheet