Products
Online Inquiry
MKT-077 (FJ-776), a highly water-soluble mitochondrial dye, demonstrates significant antitumor activity.
| Sample Types | Suspension cells, Adherent cells |
|---|---|
| Assay Type | Cell-based |
| Assay Platform | Fluorescence microscopy, Flow cytometry |
| Purity | 0.98 |
| CAS Number | 147366-41-4 |
| Formula | C21H22ClN3OS2 |
| Molecular Weight | 432.00 |
| SMILES | CN(C1=CC=CC=C1S/2)C2=C3C(N(CC)/C(S\3)=C/C4=[N+](CC)C=CC=C4)=O.[Cl-] |
| Appearance | Solid |
| Color | Brown to reddish brown |
| Solubility | DMSO: 56.67 mg/mL (131.18 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | -20°C, sealed storage, away from moisture and light |