Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize and bind to mitochondria based on membrane potential, resulting in bright fluorescence.
| Sample Types | Suspension cells, Adherent cells |
|---|---|
| Detection Method | Fluorescent |
| Assay Type | Cell-based |
| Assay Platform | Fluorescence microscopy, Flow cytometry |
| Purity | 99.73% |
| CAS Number | 62669-70-9 |
| Formula | C21H17ClN2O3 |
| Molecular Weight | 380.82 |
| SMILES | O=C(C1=CC=CC=C1C2=C3C=CC(N)=CC3=[O+]C4=C2C=CC(N)=C4)OC.[Cl-] |
| Appearance | Solid |
| Emission (Em) | 529 |
| Excitation (Ex) | 507 |
| Solubility | DMSO: 41.67 mg/mL (109.42 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | 4°C, sealed storage, away from moisture and light |
Datasheet