Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize and bind to mitochondria based on membrane potential, resulting in bright fluorescence.
| Sample Types | Suspension cells, Adherent cells |
|---|---|
| Detection Method | Fluorescent |
| Assay Type | Cell-based |
| Assay Platform | Fluorescence microscopy, Flow cytometry |
| Purity | 0.98 |
| CAS Number | 989-38-8 |
| Formula | C28H31ClN2O3 |
| Molecular Weight | 479.01 |
| SMILES | CC1=CC2=C(C3=CC=CC=C3C(OCC)=O)C4=C([O+]=C2C=C1NCC)C=C(NCC)C(C)=C4.[Cl-] |
| Appearance | Solid |
| Color | Brown to reddish brown |
| Emission (Em) | 552 |
| Excitation (Ex) | 530 |
| Solubility | DMSO: 25 mg/mL (52.19 mM, need ultrasonic). H2O: 10 mg/mL (20.88 mM, ultrasonic and warming and heat to 60°C) |
| Shipping Conditions | Room Temperature |
| Storage Information | 4°C, sealed storage, away from moisture and light |
Datasheet