Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize and bind to mitochondria based on membrane potential, resulting in bright fluorescence.
| Sample Types | Suspension cells, Adherent cells |
|---|---|
| Detection Method | Fluorescent |
| Assay Type | Cell-based |
| Assay Platform | Fluorescence microscopy, Flow cytometry |
| Purity | 99.72% |
| CAS Number | 137993-41-0 |
| Formula | C26H26ClN3O5 |
| Molecular Weight | 495.95 |
| SMILES | N#CC(C1=CC2=C3N(CCC2)CCCC3=C1[O+]=C45)=C4C=C6CCCN7CCCC5=C76.O=Cl(=O)([O-])=O |
| Appearance | Solid |
| Color | Dark purple to black |
| Emission (Em) | 704 |
| Excitation (Ex) | 682 |
| Solubility | DMSO: 83.33 mg/mL (168.02 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | 4°C, sealed storage, away from moisture and light |
Datasheet