Oligomycin A (Standard) is the analytical standard for Oligomycin A, intended for research and analytical applications. Oligomycin A (MCH 32), from Streptomyces, is a mitochondrial F0F1-ATPase inhibitor (Ki of 1 μM) and exhibits antifungal activity.
| Synonyms | MCH 32 (Standard) |
|---|---|
| Purity | 0.98 |
| Formula | C45H74O11 |
| Molecular Weight | 791.06 |
| SMILES | O=C(/C=C/[C@H](C)[C@@H](O)[C@H](C)C([C@H](C)[C@@H](O)[C@@H]1C)=O)O[C@@]([C@@H]2C)([H])[C@H](C)[C@@]3(CC[C@H](C)[C@H](C[C@H](O)C)O3)O[C@@]2([H])CC[C@@H](CC)/C=C/C=C/C[C@@H](C)[C@H](O)[C@@](C)(O)C1=O |
| Biological Target | ATP Synthase; Fungal; Antibiotic |
| Initial Source | Microorganisms |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet