Rutin (Rutoside), a flavonoid found in numerous plants, exhibits a wide array of biological activities including anti-inflammatory, antidiabetic, antioxidant, and neuroprotective effects.
| Synonyms | Rutoside; Quercetin 3-O-rutinoside |
|---|---|
| Purity | 98.09% |
| Formula | C27H30O16 |
| Molecular Weight | 610.52 |
| SMILES | O=C1C(O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O2)O)O)O)=C(C4=CC=C(O)C(O)=C4)OC5=CC(O)=CC(O)=C15 |
| Appearance | Solid |
| Biological Target | Amyloid-β; Autophagy; Apoptosis; Endogenous Metabolite |
| Target | CBR1 |
| Initial Source | Plants; Leguminosae; Glycyrrhiza uralensis Fisch.; Plants; other families |
| Solubility | DMSO: 50 mg/mL (81.90 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet