Schaftoside, a flavonoid from Chinese herbal medicines like Eleusine indica, inhibits TLR4 and Myd88 expression. It also reduces Drp1 expression, phosphorylation, and mitochondrial fission.
| Purity | 99.67% |
|---|---|
| Formula | C26H28O14 |
| Molecular Weight | 564.49 |
| SMILES | OC1=C([C@@H]([C@@H]([C@@H](O)[C@@H]2O)O)O[C@@H]2CO)C(O)=C3C(OC(C4=CC=C(O)C=C4)=CC3=O)=C1[C@H](OC[C@H](O)[C@@H]5O)[C@@H]5O |
| Appearance | Solid |
| Color | White to yellow |
| Biological Target | Toll-like Receptor (TLR); MyD88; Dynamin; Mitochondrial Metabolism; Autophagy |
| Target | TLR4 |
| Initial Source | Plants; Leguminosae; Glycyrrhiza uralensis Fisch.; Plants; Gramineae; Eleusine indica (Linn.) Gaertn. |
| Solubility | DMSO: 125 mg/mL (221.44 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet