Seneciphylline, an orally effective hepatotoxic inducer, metabolizes via CYP450 enzymes into active intermediates. These intermediates covalently bind to biomacromolecules (e.g., proteins, DNA), forming adducts that trigger toxic reactions like cell apoptosis and mitochondrial damage. It's useful for hepatotoxicity research.
| Purity | 99.93% |
|---|---|
| Formula | C18H23NO5 |
| Molecular Weight | 333.38 |
| SMILES | O=C(O[C@]1([H])CCN2[C@]1([H])C(COC([C@](C)(O)C(C/3)=C)=O)=CC2)C3=C/C |
| Appearance | Solid |
| Color | White to off-white |
| Biological Target | Glutathione S-transferase; Cytochrome P450 |
| Initial Source | Plants; Leguminosae; Sophora yunnanensis C. Y. Ma; Plants; Compositae; Plants; other families |
| Solubility | DMSO: 7.69 mg/mL (23.07 mM, ultrasonic and warming and heat to 60°C) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet