Taurodeoxycholate sodium salt, a bile salt-related anionic detergent, forms in the liver by conjugating deoxycholate with Taurine. It's used to isolate membrane proteins, including inner mitochondrial membrane proteins. Taurodeoxycholate (TDCA) demonstrates anti-inflammatory and neuroprotective effects.
| Purity | 99.80% |
|---|---|
| Formula | C26H44NNaO6S |
| Molecular Weight | 521.69 |
| SMILES | C[C@H](CCC(NCCS(=O)(O[Na])=O)=O)[C@H]1CC[C@@]2([H])[C@]3([H])CC[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C |
| Appearance | Solid |
| Color | White to off-white |
| Biological Target | Endogenous Metabolite; G protein-coupled Bile Acid Receptor 1; PARP; Apoptosis; NF-κB; PKA |
| Initial Source | Endogenous metabolite |
| Solubility | DMSO: 100 mg/mL (191.68 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet