Taurodeoxycholate sodium salt, a bile salt-related anionic detergent, forms in the liver by conjugating deoxycholate with Taurine. Taurodeoxycholic acid is used to isolate membrane proteins, including inner mitochondrial membrane proteins. It also exhibits anti-inflammatory and neuroprotective effects.
| Purity | 0.98 |
|---|---|
| Formula | C26H45NO6S |
| Molecular Weight | 499.70 |
| SMILES | C[C@@]12[C@](CC[C@]2([H])[C@H](C)CCC(NCCS(=O)(O)=O)=O)([H])[C@@]3([H])[C@@](C[C@@H]1O)([H])[C@@]4([C@](C[C@@H](CC4)O)([H])CC3)C |
| Appearance | Solid |
| Color | White to off-white |
| Biological Target | Endogenous Metabolite; G protein-coupled Bile Acid Receptor 1; PARP; Apoptosis; NF-κB; PKA |
| Target | Microbial Metabolite |
| Initial Source | Microorganisms; Endogenous metabolite |
| Solubility | DMSO: 100 mg/mL (200.12 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet