Xylopine, an aporphine alkaloid, exhibits cytotoxic activity against cancer cells. It induces oxidative stress, leading to G2/M cell cycle arrest and apoptosis in cancer cells.
| Purity | 0.98 |
|---|---|
| Formula | C18H17NO3 |
| Molecular Weight | 295.33 |
| SMILES | COC1=CC=C2C3=C4C(CCN[C@]4([H])CC2=C1)=CC5=C3OCO5 |
| Appearance | Solid |
| Color | Light yellow to yellow |
| Biological Target | Reactive Oxygen Species; Apoptosis |
| Initial Source | Plants; other families |
| Solubility | DMSO: 50 mg/mL (169.30 mM, need ultrasonic) |
| Shipping Conditions | Room Temperature |
| Storage Information | Powder: -80°C, 2 years; -20°C, 1 years. In solvent: -80°C, 6 months; -20°C, 1 month |
Datasheet