Online Inquiry
Inquiry
Calcipotriol
Description
Calcipotriol is a low-calcemic vitamin D receptor (VDR) agonist.
Basic Information
| Synonyms: | MC 903; Calcipotriene |
| CAS Number: | 112965-21-6 |
| Formula: | C27H40O3 |
| Molecular Weight: | 412.6 |
| SMILES: | C[C@H](/C=C/[C@H](C1CC1)O)[C@H]2CC[C@@H]\3[C@@]2(CCC/C3=C\C=C/4\C[C@H](C[C@@H](C4=C)O)O)C |
| Solubility-In vitro: | DMSO: 73 mg/mL (176.92 mM) Water: Insoluble Ethanol: 73 mg/mL (176.92 mM) * <1 mg/ml means slightly soluble or insoluble. |
Storage
|
The lyophilized form should be stored at -20°C, in a desiccated environment. In lyophilized form, the chemical remains stable for 36 months. In solution, it should be stored at -20°C and used within 3 months to prevent loss of potency. Aliquoting is recommended to avoid multiple freeze/thaw cycles. |
Preparing Stock Solutions
| 0.1 mM_1 mg: | 24.24 mL |
| 0.1 mM_5 mg: | 121.18 mL |
| 0.1 mM_10 mg: | 242.37 mL |
| 0.5 mM_1 mg: | 4.85 mL |
| 0.5 mM_5 mg: | 24.24 mL |
| 0.5 mM_10 mg: | 48.47 mL |
| 1 mM_1 mg: | 2.42 mL |
| 1 mM_5 mg: | 12.12 mL |
| 1 mM_10 mg: | 24.24 mL |
| 5 mM_1 mg: | 0.48 mL |
| 5 mM_5 mg: | 2.42 mL |
| 5 mM_10 mg: | 4.85 mL |
All of our services and products are intended for preclinical research use only and cannot be used to diagnose, treat or manage patients.
