Online Inquiry
Inquiry
Folic acid
Description
Folic acid is a B vitamin that is necessary for the production and maintenance of new cells, DNA synthesis, and RNA synthesis.
Basic Information
| Synonyms: | Folacin; Vitamin B9; Vitamin M |
| CAS Number: | 59-30-3 |
| Formula: | C19H19N7O6 |
| Molecular Weight: | 441.4 |
| SMILES: | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)N=C(N3)N |
| Solubility-In vitro: | DMSO: Warmed: 2 mg/mL (4.53 mM) Water: Insoluble Ethanol: Insoluble * <1 mg/ml means slightly soluble or insoluble. |
Target Info
|
Human Endogenous Metabolite Microbial Metabolite |
Storage
|
The lyophilized form should be stored at -20°C, in a desiccated environment. In lyophilized form, the chemical remains stable for 36 months. In solution, it should be stored at -20°C and used within 3 months to prevent loss of potency. Aliquoting is recommended to avoid multiple freeze/thaw cycles. |
Preparing Stock Solutions
| 0.1 mM_1 mg: | 22.66 mL |
| 0.1 mM_5 mg: | 113.28 mL |
| 0.1 mM_10 mg: | 226.55 mL |
| 0.5 mM_1 mg: | 4.53 mL |
| 0.5 mM_5 mg: | 22.66 mL |
| 0.5 mM_10 mg: | 45.31 mL |
| 1 mM_1 mg: | 2.27 mL |
| 1 mM_5 mg: | 11.33 mL |
| 1 mM_10 mg: | 22.66 mL |
| 5 mM_1 mg: | 0.45 mL |
| 5 mM_5 mg: | 2.27 mL |
| 5 mM_10 mg: | 4.53 mL |
All of our services and products are intended for preclinical research use only and cannot be used to diagnose, treat or manage patients.
