Online Inquiry
Inquiry
(S)-Pulegone
-Pulegone.png.png)
Description
(S)-Pulegone is a monoterpenoid that serves as a particularly attractive chiral starting material for the synthesis of more complex natural products. This compound also shows antimalarial properties.
Basic Information
| CAS Number: | 3391-90-0 |
| Formula: | C10H16O |
| Molecular Weight: | 152.23 |
| Synonyms: | (S)-(-)-Pulegone; (-)-Pulegone; (S)-p-Menth-4(8)-en-3-one; (S)-2-Isopropylidene-5-methylcyclohexanone |
| InChi Key: | NZGWDASTMWDZIW-QMMMGPOBSA-N |
| Appearance: | Clear light yellow liquid |
| Identity: | Determined by 1H-NMR. |
| Purity Chemicals: | ≥98% (GC) |
| SMILES: | C[C@@H](CC/C1=C(C)/C)CC1=O |
| Solubility: | Soluble in chloroform or acetone. |
| Source/Host Chemicals: | Synthetic |
Shipping and Handling
| Storage (Short Term): | 4°C |
| Storage (Long Term): | 4°C |
| Shipping: | Ambient |
| Handling Advice: | Protect from moisture and light. |
| Stability: | When stored at a temperature of +4°C, it remains stable for at least 2 years. |
All of our services and products are intended for preclinical research use only and cannot be used to diagnose, treat or manage patients.
